EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H39NO6 |
| Net Charge | 0 |
| Average Mass | 389.533 |
| Monoisotopic Mass | 389.27774 |
| SMILES | CCCCCC[C@@H](O)CCCCCC/C=C/[C@H](O)[C@@H](O)[C@H](O)[C@H](N)C(=O)O |
| InChI | InChI=1S/C20H39NO6/c1-2-3-4-9-12-15(22)13-10-7-5-6-8-11-14-16(23)18(24)19(25)17(21)20(26)27/h11,14-19,22-25H,2-10,12-13,21H2,1H3,(H,26,27)/b14-11+/t15-,16+,17+,18-,19-/m1/s1 |
| InChIKey | UAPFYKYEEDCCTL-MXSQXUFFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Aspergillus (ncbitaxon:5052) | - | DOI (10.1016/s0040-4039(00)74115-3) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Sphingofungin B (CHEBI:185613) is a long-chain fatty acid (CHEBI:15904) |
| Sphingofungin B (CHEBI:185613) is tautomer of sphingofungin B zwitterion (CHEBI:231807) |
| Incoming Relation(s) |
| sphingofungin B zwitterion (CHEBI:231807) is tautomer of Sphingofungin B (CHEBI:185613) |
| IUPAC Names |
|---|
| (E,2S,3R,4R,5S,14R)-2-amino-3,4,5,14-tetrahydroxyicos-6-enoic acid |
| (E,2S,3R,4R,5S)-2-amino-3,4,5,14-tetrahydroxyicos-6-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| LMSP01080062 | LIPID MAPS |
| 4943512 | ChemSpider |
| 8605863 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:121025-45-4 | ChemIDplus |