EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H16Br2N5O4P |
| Net Charge | 0 |
| Average Mass | 449.040 |
| Monoisotopic Mass | 446.93066 |
| SMILES | Cn1c(COP(=O)(NCCBr)NCCBr)cnc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H16Br2N5O4P/c1-15-8(6-12-9(15)16(17)18)7-20-21(19,13-4-2-10)14-5-3-11/h6H,2-5,7H2,1H3,(H2,13,14,19) |
| InChIKey | UGJWRPJDTDGERK-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | alkylating agent Highly reactive chemical that introduces alkyl radicals into biologically active molecules and thereby prevents their proper functioning. It could be used as an antineoplastic agent, but it might be very toxic, with carcinogenic, mutagenic, teratogenic, and immunosuppressant actions. It could also be used as a component of poison gases. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| evofosfamide (CHEBI:231678) has role alkylating agent (CHEBI:22333) |
| evofosfamide (CHEBI:231678) has role antineoplastic agent (CHEBI:35610) |
| evofosfamide (CHEBI:231678) has role prodrug (CHEBI:50266) |
| evofosfamide (CHEBI:231678) is a C-nitro compound (CHEBI:35716) |
| evofosfamide (CHEBI:231678) is a imidazoles (CHEBI:24780) |
| evofosfamide (CHEBI:231678) is a organobromine compound (CHEBI:37141) |
| evofosfamide (CHEBI:231678) is a phosphorodiamidate ester (CHEBI:60284) |
| evofosfamide (CHEBI:231678) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| (1-methyl-2-nitro-1H-imidazol-5-yl)methyl N,N'-bis(2-bromoethyl)phosphorodiamidate |
| INNs | Source |
|---|---|
| évofosfamide | WHO MedNet |
| evofosfamidum | WHO MedNet |
| evofosfamida | WHO MedNet |
| evofosfamide | WHO MedNet |
| Synonyms | Source |
|---|---|
| TH-302 | SUBMITTER |
| TH302 | SUBMITTER |
| TH 302 | ChEBI |
| 2-bromo-N-[(2-bromoethylamino)-[(3-methyl-2-nitroimidazol-4-yl)methoxy]phosphoryl]ethanamine | ChEBI |
| HAP-302 | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| DB06091 | DrugBank |
| D10704 | KEGG DRUG |
| Evofosfamide | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:918633-87-1 | SUBMITTER |
| Citations |
|---|