EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H30N6O12 |
| Net Charge | -2 |
| Average Mass | 606.545 |
| Monoisotopic Mass | 606.19327 |
| SMILES | NC(=[NH2+])NCCC[C@@H]1NC(=O)/C(=C/c2ccc(O)c(OCC[C@H](NC(=O)C[C@](O)(CC(=O)[O-])C(=O)[O-])C(=O)[O-])c2)NC1=O |
| InChI | InChI=1S/C25H32N6O12/c26-24(27)28-6-1-2-13-20(36)31-15(21(37)30-13)8-12-3-4-16(32)17(9-12)43-7-5-14(22(38)39)29-18(33)10-25(42,23(40)41)11-19(34)35/h3-4,8-9,13-14,32,42H,1-2,5-7,10-11H2,(H,29,33)(H,30,37)(H,31,36)(H,34,35)(H,38,39)(H,40,41)(H4,26,27,28)/p-2/b15-8-/t13-,14-,25-/m0/s1 |
| InChIKey | GRAFKVRBLJRCBH-NCBISDQCSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| NK13650 B(2−) (CHEBI:231317) has functional parent cyclo(L-arginyl-(Z)-dehydro-4-O-homoseryl-tyrosyl) (CHEBI:231316) |
| NK13650 B(2−) (CHEBI:231317) is a guanidinium ion (CHEBI:60251) |
| NK13650 B(2−) (CHEBI:231317) is a α-amino-acid cation (CHEBI:33719) |
| NK13650 B(2−) (CHEBI:231317) is conjugate base of NK13650B (CHEBI:215284) |
| Incoming Relation(s) |
| NK13650 C(3−) (CHEBI:231319) has functional parent NK13650 B(2−) (CHEBI:231317) |
| NK13650 D(2−) (CHEBI:231318) has functional parent NK13650 B(2−) (CHEBI:231317) |
| NK13650B (CHEBI:215284) is conjugate acid of NK13650 B(2−) (CHEBI:231317) |
| UniProt Name | Source |
|---|---|
| NK13650 B | UniProt |
| Citations |
|---|