EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H32N6O12 |
| Net Charge | 0 |
| Average Mass | 608.561 |
| Monoisotopic Mass | 608.20782 |
| SMILES | N=C(N)NCCC[C@@H]1NC(=O)/C(=C/c2ccc(O)c(OCC[C@H](NC(=O)C[C@](O)(CC(=O)O)C(=O)O)C(=O)O)c2)NC1=O |
| InChI | InChI=1S/C25H32N6O12/c26-24(27)28-6-1-2-13-20(36)31-15(21(37)30-13)8-12-3-4-16(32)17(9-12)43-7-5-14(22(38)39)29-18(33)10-25(42,23(40)41)11-19(34)35/h3-4,8-9,13-14,32,42H,1-2,5-7,10-11H2,(H,29,33)(H,30,37)(H,31,36)(H,34,35)(H,38,39)(H,40,41)(H4,26,27,28)/b15-8-/t13-,14-,25-/m0/s1 |
| InChIKey | GRAFKVRBLJRCBH-NCBISDQCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicilliumspecies (ncbitaxon:5081) | - | PubMed (22984806) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| NK13650B (CHEBI:215284) is a 2,5-diketopiperazines (CHEBI:65061) |
| NK13650B (CHEBI:215284) is a aromatic ether (CHEBI:35618) |
| NK13650B (CHEBI:215284) is a guanidines (CHEBI:24436) |
| NK13650B (CHEBI:215284) is a phenols (CHEBI:33853) |
| NK13650B (CHEBI:215284) is a tricarboxylic acid (CHEBI:27093) |
| NK13650B (CHEBI:215284) is conjugate acid of NK13650 B(2−) (CHEBI:231317) |
| Incoming Relation(s) |
| NK13650 B(2−) (CHEBI:231317) is conjugate base of NK13650B (CHEBI:215284) |
| IUPAC Name |
|---|
| (2S)-2-(2-{[(1S)-3-(5-{(Z)-[(5S)-5-(3-carbamimidamidopropyl)-3,6-dioxopiperazin-2-ylidene]methyl}-2-hydroxyphenoxy)-1-carboxypropyl]amino}-2-oxoethyl)-2-hydroxybutanedioic acid |
| Synonym | Source |
|---|---|
| NK13650 B | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 78444173 | ChemSpider |
| Citations |
|---|