EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H21N3O3 |
| Net Charge | 0 |
| Average Mass | 423.472 |
| Monoisotopic Mass | 423.15829 |
| SMILES | O=c1c(Cc2ccc(O)cc2)nc2c(Cc3ccccc3)nc(-c3ccc(O)cc3)cn1-2 |
| InChI | InChI=1S/C26H21N3O3/c30-20-10-6-18(7-11-20)15-23-26(32)29-16-24(19-8-12-21(31)13-9-19)27-22(25(29)28-23)14-17-4-2-1-3-5-17/h1-13,16,27,30-31H,14-15H2 |
| InChIKey | YHIPILPTUVMWQT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | luciferin A low-molecular-mass compound present in bioluminescent organisms that emits light when oxidized in presence of enzyme luciferase. |
| Biological Role: | luciferin A low-molecular-mass compound present in bioluminescent organisms that emits light when oxidized in presence of enzyme luciferase. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Oplophorus luciferin (CHEBI:2311) has parent hydride imidazo[1,2-a]pyrazine (CHEBI:37846) |
| Oplophorus luciferin (CHEBI:2311) has role luciferin (CHEBI:25078) |
| Oplophorus luciferin (CHEBI:2311) is a imidazopyrazine (CHEBI:37847) |
| Oplophorus luciferin (CHEBI:2311) is a phenols (CHEBI:33853) |
| Incoming Relation(s) |
| Watasenia luciferin (CHEBI:17675) has functional parent Oplophorus luciferin (CHEBI:2311) |
| 2-hydroperoxycoelenterazine (CHEBI:41712) has functional parent Oplophorus luciferin (CHEBI:2311) |
| 2-hydroxycoelenterazine (CHEBI:41738) has functional parent Oplophorus luciferin (CHEBI:2311) |
| coelenterazine 2-hydroperoxide (CHEBI:139323) has functional parent Oplophorus luciferin (CHEBI:2311) |
| coelenterazine dioxetanone (CHEBI:139324) has functional parent Oplophorus luciferin (CHEBI:2311) |
| oxidized Oplophorus luciferin (CHEBI:41487) has functional parent Oplophorus luciferin (CHEBI:2311) |
| IUPAC Name |
|---|
| 8-benzyl-2-(4-hydroxybenzyl)-6-(4-hydroxyphenyl)imidazo[1,2-a]pyrazin-3(7H)-one |
| Synonyms | Source |
|---|---|
| 8-Benzyl-2-(4-hydroxybenzyl)-6-(4-hydroxyphenyl)imidazo-[1,2a]pyrazin-3(7H)-one | KEGG COMPOUND |
| coelenterate luciferin | ChEBI |
| coelenterazine | ChEBI |
| Coelenterazine | KEGG COMPOUND |
| Oplophorus luciferin | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| coelenterazine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C15037 | KEGG COMPOUND |
| OPLOPHORUS-LUCIFERIN | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Beilstein:902535 | Beilstein |
| CAS:55779-48-1 | KEGG COMPOUND |