EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H21N3O5 |
| Net Charge | 0 |
| Average Mass | 455.470 |
| Monoisotopic Mass | 455.14812 |
| SMILES | O=C1N2C=C(c3ccc(O)cc3)N=C(Cc3ccccc3)C2=NC1(Cc1ccc(O)cc1)OO |
| InChI | InChI=1S/C26H21N3O5/c30-20-10-6-18(7-11-20)15-26(34-33)25(32)29-16-23(19-8-12-21(31)13-9-19)27-22(24(29)28-26)14-17-4-2-1-3-5-17/h1-13,16,30-31,33H,14-15H2 |
| InChIKey | HOSWCJDTHOAORT-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Obelia longissima (ncbitaxon:32570) | - | PubMed (19795783) |
| Roles Classification |
|---|
| Chemical Role: | |
| Biological Roles: | marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| coelenterazine 2-hydroperoxide (CHEBI:139323) has functional parent Oplophorus luciferin (CHEBI:2311) |
| coelenterazine 2-hydroperoxide (CHEBI:139323) has role marine metabolite (CHEBI:76507) |
| coelenterazine 2-hydroperoxide (CHEBI:139323) has role oxidized luciferins (CHEBI:25747) |
| coelenterazine 2-hydroperoxide (CHEBI:139323) is a imidazopyrazine (CHEBI:37847) |
| coelenterazine 2-hydroperoxide (CHEBI:139323) is a peroxol (CHEBI:35924) |
| coelenterazine 2-hydroperoxide (CHEBI:139323) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| 8-benzyl-2-hydroperoxy-6-(4-hydroxyphenyl)-2-[(4-hydroxyphenyl)methyl]imidazo[1,2-a]pyrazin-3(2H)-one |
| Synonym | Source |
|---|---|
| 2-hydroperoxycoelenterazine | ChEBI |
| UniProt Name | Source |
|---|---|
| coelenterazine-2-hydroperoxide | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-20222 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:867464 | Reaxys |
| Citations |
|---|