EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H9O4 |
| Net Charge | -1 |
| Average Mass | 181.167 |
| Monoisotopic Mass | 181.05063 |
| SMILES | O=C([O-])CC(O)c1ccc(O)cc1 |
| InChI | InChI=1S/C9H10O4/c10-7-3-1-6(2-4-7)8(11)5-9(12)13/h1-4,8,10-11H,5H2,(H,12,13)/p-1 |
| InChIKey | AKWHTKRUNUYXDS-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-hydroxy-3-(4-hydroxyphenyl)propanoate (CHEBI:229975) is a monocarboxylic acid anion (CHEBI:35757) |
| 3-hydroxy-3-(4-hydroxyphenyl)propanoate (CHEBI:229975) is conjugate base of Dihydroxyphenylpropionic acid (CHEBI:166658) |
| Incoming Relation(s) |
| Dihydroxyphenylpropionic acid (CHEBI:166658) is conjugate acid of 3-hydroxy-3-(4-hydroxyphenyl)propanoate (CHEBI:229975) |
| UniProt Name | Source |
|---|---|
| 3-hydroxy-3-(4-hydroxyphenyl)propanoate | UniProt |