EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10O4 |
| Net Charge | 0 |
| Average Mass | 182.175 |
| Monoisotopic Mass | 182.05791 |
| SMILES | O=C(O)CC(O)c1ccc(O)cc1 |
| InChI | InChI=1S/C9H10O4/c10-7-3-1-6(2-4-7)8(11)5-9(12)13/h1-4,8,10-11H,5H2,(H,12,13) |
| InChIKey | AKWHTKRUNUYXDS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Dihydroxyphenylpropionic acid (CHEBI:166658) is a benzenes (CHEBI:22712) |
| Dihydroxyphenylpropionic acid (CHEBI:166658) is a monocarboxylic acid (CHEBI:25384) |
| Dihydroxyphenylpropionic acid (CHEBI:166658) is conjugate acid of 3-hydroxy-3-(4-hydroxyphenyl)propanoate (CHEBI:229975) |
| Incoming Relation(s) |
| 3-hydroxy-3-(4-hydroxyphenyl)propanoate (CHEBI:229975) is conjugate base of Dihydroxyphenylpropionic acid (CHEBI:166658) |
| IUPAC Name |
|---|
| 3-hydroxy-3-(4-hydroxyphenyl)propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 13612541 | ChemSpider |
| HMDB0124923 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:76833-34-6 | ChemIDplus |