EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H26N9O8P |
| Net Charge | 0 |
| Average Mass | 503.413 |
| Monoisotopic Mass | 503.16420 |
| SMILES | N=C(N)NCCC[C@H](N)C(=O)OP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H26N9O8P/c17-7(2-1-3-21-16(19)20)15(28)33-34(29,30)31-4-8-10(26)11(27)14(32-8)25-6-24-9-12(18)22-5-23-13(9)25/h5-8,10-11,14,26-27H,1-4,17H2,(H,29,30)(H2,18,22,23)(H4,19,20,21)/t7-,8+,10+,11+,14+/m0/s1 |
| InChIKey | AJYPLWAQPDERQG-TWBCTODHSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-arginyl-AMP (CHEBI:229719) has functional parent adenosine 5'-monophosphate (CHEBI:16027) |
| L-arginyl-AMP (CHEBI:229719) is a L-arginine ester (CHEBI:27621) |
| L-arginyl-AMP (CHEBI:229719) is a adenosine 5'-phosphate (CHEBI:37096) |
| L-arginyl-AMP (CHEBI:229719) is a purine ribonucleoside 5'-monophosphate (CHEBI:37021) |
| L-arginyl-AMP (CHEBI:229719) is conjugate base of L-arginyl-AMP(1+) (CHEBI:144944) |
| Incoming Relation(s) |
| L-arginyl-AMP(1+) (CHEBI:144944) is conjugate acid of L-arginyl-AMP (CHEBI:229719) |
| IUPAC Name |
|---|
| 5'-O-[{[(2S)-2-amino-5-carbamimidamidopentanoyl]oxy}(hydroxy)phosphoryl]adenosine |
| Synonyms | Source |
|---|---|
| arginyl adenylate | ChEBI |
| L-arginyl adenylate | ChEBI |
| (L-arginyl)adenylate | ChEBI |
| L-arginyl-adenylate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C22264 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:15470-08-3 | PubChem Compound |
| Citations |
|---|