EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H17N4O4 |
| Net Charge | +1 |
| Average Mass | 269.281 |
| Monoisotopic Mass | 269.12443 |
| SMILES | OC[C@H]1O[C@@H](n2cnc3c2[NH+]=CNC[C@H]3O)C[C@@H]1O |
| InChI | InChI=1S/C11H16N4O4/c16-3-8-6(17)1-9(19-8)15-5-14-10-7(18)2-12-4-13-11(10)15/h4-9,16-18H,1-3H2,(H,12,13)/p+1/t6-,7+,8+,9+/m0/s1 |
| InChIKey | FPVKHBSQESCIEP-JQCXWYLXSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pentostatin(1+) (CHEBI:229687) is a organic cation (CHEBI:25697) |
| pentostatin(1+) (CHEBI:229687) is conjugate acid of pentostatin (CHEBI:27834) |
| Incoming Relation(s) |
| pentostatin (CHEBI:27834) is conjugate base of pentostatin(1+) (CHEBI:229687) |
| IUPAC Name |
|---|
| (8R)-3-(2-deoxy-β-D-erythro-pentofuranosyl)-8-hydroxy-3,6,7,8-tetrahydroimidazo[4,5-d][1,3]diazepin-4-ium |
| Synonym | Source |
|---|---|
| pentostatin cation | ChEBI |
| UniProt Name | Source |
|---|---|
| pentostatin | UniProt |
| Citations |
|---|