EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H17N4O2 |
| Net Charge | +1 |
| Average Mass | 189.239 |
| Monoisotopic Mass | 189.13460 |
| SMILES | C[C@H](CCNC(N)=[NH2+])[C@H]([NH3+])C(=O)[O-] |
| InChI | InChI=1S/C7H16N4O2/c1-4(5(8)6(12)13)2-3-11-7(9)10/h4-5H,2-3,8H2,1H3,(H,12,13)(H4,9,10,11)/p+1/t4-,5+/m1/s1 |
| InChIKey | VRWSVIUPXSFVFZ-UHNVWZDZSA-O |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | toxin Poisonous substance produced by a biological organism such as a microbe, animal or plant. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3R)-3-methyl-L-arginine zwitterion (CHEBI:229593) is a 3-methylarginine (CHEBI:171656) |
| UniProt Name | Source |
|---|---|
| (3R)-3-methyl-L-arginine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-12429 | MetaCyc |
| Citations |
|---|