EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H16N4O2 |
| Net Charge | 0 |
| Average Mass | 188.231 |
| Monoisotopic Mass | 188.12733 |
| SMILES | CC(CCNC(=N)N)C(N)C(=O)O |
| InChI | InChI=1S/C7H16N4O2/c1-4(5(8)6(12)13)2-3-11-7(9)10/h4-5H,2-3,8H2,1H3,(H,12,13)(H4,9,10,11) |
| InChIKey | VRWSVIUPXSFVFZ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pseudomonas syringae pv. syringae (ncbitaxon:321) | - | PubMed (18655083 ) | Strain: 22d/93 |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. toxin Poisonous substance produced by a biological organism such as a microbe, animal or plant. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-methylarginine (CHEBI:171656) has functional parent arginine (CHEBI:29016) |
| 3-methylarginine (CHEBI:171656) has role antibacterial agent (CHEBI:33282) |
| 3-methylarginine (CHEBI:171656) has role bacterial metabolite (CHEBI:76969) |
| 3-methylarginine (CHEBI:171656) has role toxin (CHEBI:27026) |
| 3-methylarginine (CHEBI:171656) is a guanidines (CHEBI:24436) |
| 3-methylarginine (CHEBI:171656) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| 3-methylarginine (CHEBI:171656) is a polar amino acid (CHEBI:26167) |
| Incoming Relation(s) |
| (3R)-3-methyl-L-arginine zwitterion (CHEBI:229593) is a 3-methylarginine (CHEBI:171656) |
| IUPAC Name |
|---|
| 5-carbamimidamidoisoleucine |
| Synonyms | Source |
|---|---|
| 2-amino-5-carbamimidamido-3-methylpentanoic acid | IUPAC |
| 2-amino-5-(diaminomethylideneamino)-3-methylpentanoic acid | ChEBI |
| 3-MeArg | SUBMITTER |
| 3-methyl-Arg | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-12429 | MetaCyc |
| Citations |
|---|