EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H13N |
| Net Charge | 0 |
| Average Mass | 135.210 |
| Monoisotopic Mass | 135.10480 |
| SMILES | CC(CN)c1ccccc1 |
| InChI | InChI=1S/C9H13N/c1-8(7-10)9-5-3-2-4-6-9/h2-6,8H,7,10H2,1H3 |
| InChIKey | AXORVIZLPOGIRG-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | MetaboLights (MTBLS8090) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antihypotensive agent A cardiovascular drug that tends to raise reduced blood pressure. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-phenylpropylamine (CHEBI:229522) has role antihypotensive agent (CHEBI:137431) |
| 2-phenylpropylamine (CHEBI:229522) is a benzenes (CHEBI:22712) |
| 2-phenylpropylamine (CHEBI:229522) is a phenylalkylamine (CHEBI:60977) |
| Incoming Relation(s) |
| (R)-2-phenylpropylamine (CHEBI:188982) is a 2-phenylpropylamine (CHEBI:229522) |
| (S)-2-phenylpropylamine (CHEBI:229525) is a 2-phenylpropylamine (CHEBI:229522) |
| IUPAC Name |
|---|
| 2-phenylpropan-1-amine |
| Synonyms | Source |
|---|---|
| 1-amino-2-phenylpropane | ChEBI |
| 2-phenyl-1-propanamine | ChEBI |
| 2-phenyl-1-propylamine | NIST Chemistry WebBook |
| (2-phenylpropyl)amine | ChEBI |
| beta-methylphenethylamine | ChEBI |
| BMPEA | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 10920 | ChemSpider |
| Beta-methylphenethylamine | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:582-22-9 | NIST Chemistry WebBook |
| Citations |
|---|