EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H13N |
| Net Charge | 0 |
| Average Mass | 135.210 |
| Monoisotopic Mass | 135.10480 |
| SMILES | C[C@@H](CN)c1ccccc1 |
| InChI | InChI=1S/C9H13N/c1-8(7-10)9-5-3-2-4-6-9/h2-6,8H,7,10H2,1H3/t8-/m0/s1 |
| InChIKey | AXORVIZLPOGIRG-QMMMGPOBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Staphylococcus Aureus (ncbitaxon:1280) | whole organism (UBERON:0000468) | MetaboLights (MTBLS3859) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antihypotensive agent A cardiovascular drug that tends to raise reduced blood pressure. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-2-phenylpropylamine (CHEBI:188982) is a 2-phenylpropylamine (CHEBI:229522) |
| (R)-2-phenylpropylamine (CHEBI:188982) is enantiomer of (S)-2-phenylpropylamine (CHEBI:229525) |
| Incoming Relation(s) |
| (S)-2-phenylpropylamine (CHEBI:229525) is enantiomer of (R)-2-phenylpropylamine (CHEBI:188982) |
| IUPAC Name |
|---|
| (2R)-2-phenylpropan-1-amine |
| Synonyms | Source |
|---|---|
| (R)-(+)-β-methylphenethylamine | ChEBI |
| (R)-2-phenyl-1-propylamine | ChEBI |
| (R)-(+)-beta-methylphenethylamine | ChEBI |
| (2R)-(+)-2-phenylpropylamine | ChEBI |
| (+)-2-phenylpropylamine | ChEBI |
| (+)-β-methylphenethylamine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 1265051 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3195646 | Reaxys |
| CAS:28163-64-6 | ChEBI |
| Citations |
|---|