EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H28O3 |
| Net Charge | 0 |
| Average Mass | 304.430 |
| Monoisotopic Mass | 304.20384 |
| SMILES | [H][C@]12CC[C@]3(C)[C@@H](O)CC[C@@]3([H])[C@]1([H])[C@H](O)CC1=CC(=O)CC[C@@]12C |
| InChI | InChI=1S/C19H28O3/c1-18-7-5-12(20)9-11(18)10-15(21)17-13-3-4-16(22)19(13,2)8-6-14(17)18/h9,13-17,21-22H,3-8,10H2,1-2H3/t13-,14-,15+,16-,17-,18-,19-/m0/s1 |
| InChIKey | RNCGWYKXAJCOLD-JUKXBMAYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Daphnia magna (ncbitaxon:35525) | - | Article (Alteration of [14C]-Testosterone Metabolism After Chronic Exposure of Daphnia magna to TributyltinE. Oberdörster, D. Rittschof, G. A. LeBlancArch. Environ. Contam. Toxicol. 34, 21-25 (1998)) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (1175644) |
| Roles Classification |
|---|
| Biological Roles: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. Daphnia magna metabolite A Daphnia metabolite produced by the species Daphnia magna. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7α -hydroxytestosterone (CHEBI:2295) has functional parent testosterone (CHEBI:17347) |
| 7α -hydroxytestosterone (CHEBI:2295) has role Daphnia magna metabolite (CHEBI:83056) |
| 7α -hydroxytestosterone (CHEBI:2295) has role androgen (CHEBI:50113) |
| 7α -hydroxytestosterone (CHEBI:2295) has role mouse metabolite (CHEBI:75771) |
| 7α -hydroxytestosterone (CHEBI:2295) is a 17β-hydroxy steroid (CHEBI:35343) |
| 7α -hydroxytestosterone (CHEBI:2295) is a 3-oxo-Δ4 steroid (CHEBI:47909) |
| 7α -hydroxytestosterone (CHEBI:2295) is a 7α-hydroxy steroid (CHEBI:36843) |
| 7α -hydroxytestosterone (CHEBI:2295) is a androstanoid (CHEBI:50402) |
| IUPAC Name |
|---|
| 7α,17β-dihydroxyandrost-4-en-3-one |
| Manual Xrefs | Databases |
|---|---|
| C05291 | KEGG COMPOUND |
| HMDB0003956 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2625821 | Reaxys |
| CAS:62-83-9 | KEGG COMPOUND |
| Citations |
|---|