EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H8O6 |
| Net Charge | 0 |
| Average Mass | 188.135 |
| Monoisotopic Mass | 188.03209 |
| SMILES | O=C(O)/C=C(/CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C7H8O6/c8-5(9)2-1-4(7(12)13)3-6(10)11/h3H,1-2H2,(H,8,9)(H,10,11)(H,12,13)/b4-3- |
| InChIKey | BJYPZFUWWJSAKC-ARJAWSKDSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| but-1-ene-1,2,4-tricarboxylic acid (CHEBI:17516) is a tricarboxylic acid (CHEBI:27093) |
| but-1-ene-1,2,4-tricarboxylic acid (CHEBI:17516) is conjugate acid of but-1-ene-1,2,4-tricarboxylate (CHEBI:58174) |
| Incoming Relation(s) |
| (1E)-4-oxobut-1-ene-1,2,4-tricarboxylic acid (CHEBI:15668) has functional parent but-1-ene-1,2,4-tricarboxylic acid (CHEBI:17516) |
| but-1-ene-1,2,4-tricarboxylate (CHEBI:58174) is conjugate base of but-1-ene-1,2,4-tricarboxylic acid (CHEBI:17516) |
| IUPAC Name |
|---|
| (1Z)-but-1-ene-1,2,4-tricarboxylic acid |
| Synonyms | Source |
|---|---|
| But-1-ene-1,2,4-tricarboxylate | KEGG COMPOUND |
| cis-Homoaconitate | KEGG COMPOUND |
| Homo-cis-aconitate | KEGG COMPOUND |
| (Z)-1,2,4-But-1-enetricarboxylic acid | KEGG COMPOUND |