EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H27N3O6 |
| Net Charge | 0 |
| Average Mass | 393.440 |
| Monoisotopic Mass | 393.18999 |
| SMILES | O=C(O)CNC(=O)C1C(=O)N(C2CCCCC2)C(=O)N(C2CCCCC2)C1=O |
| InChI | InChI=1S/C19H27N3O6/c23-14(24)11-20-16(25)15-17(26)21(12-7-3-1-4-8-12)19(28)22(18(15)27)13-9-5-2-6-10-13/h12-13,15H,1-11H2,(H,20,25)(H,23,24) |
| InChIKey | RUEYEZADQJCKGV-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | EC 1.14.11.29 (hypoxia-inducible factor-proline dioxygenase) inhibitor An EC 1.14.11.* (oxidoreductase acting on paired donors, 2-oxoglutarate as one donor, incorporating 1 atom each of oxygen into both donors) inhibitor that interferes with the action of hypoxia-inducible factor-proline dioxygenase (EC 1.14.11.29). antiviral agent A substance that destroys or inhibits replication of viruses. GABA modulator A substance that does not act as agonist or antagonist but does affect the gamma-aminobutyric acid receptor-ionophore complex. GABA-A receptors appear to have at least three allosteric sites at which modulators act: a site at which benzodiazepines act by increasing the opening frequency of gamma-aminobutyric acid-activated chloride channels; a site at which barbiturates act to prolong the duration of channel opening; and a site at which some steroids may act. |
| Applications: | vulnerary A drug used in treating and healing of wounds. anti-anaemic agent A compound which increases either the number of red cells or the amount of haemoglobin in the blood. GABA modulator A substance that does not act as agonist or antagonist but does affect the gamma-aminobutyric acid receptor-ionophore complex. GABA-A receptors appear to have at least three allosteric sites at which modulators act: a site at which benzodiazepines act by increasing the opening frequency of gamma-aminobutyric acid-activated chloride channels; a site at which barbiturates act to prolong the duration of channel opening; and a site at which some steroids may act. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| daprodustat (CHEBI:229223) has role anti-anaemic agent (CHEBI:75835) |
| daprodustat (CHEBI:229223) has role antiviral agent (CHEBI:22587) |
| daprodustat (CHEBI:229223) has role EC 1.14.11.29 (hypoxia-inducible factor-proline dioxygenase) inhibitor (CHEBI:102248) |
| daprodustat (CHEBI:229223) has role vulnerary (CHEBI:73336) |
| daprodustat (CHEBI:229223) is a N-acylglycine (CHEBI:16180) |
| daprodustat (CHEBI:229223) is a barbiturates (CHEBI:22693) |
| daprodustat (CHEBI:229223) is a organic molecular entity (CHEBI:50860) |
| daprodustat (CHEBI:229223) is a oxo monocarboxylic acid (CHEBI:35871) |
| daprodustat (CHEBI:229223) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| N-[(1,3-dicyclohexyl-2,4,6-trioxohexahydropyrimidin-5-yl)carbonyl]glycine |
| INNs | Source |
|---|---|
| daprodustat | WHO MedNet |
| daprodustat | WHO MedNet |
| daprodustat | WHO MedNet |
| daprodustatum | WHO MedNet |
| Synonyms | Source |
|---|---|
| {[(1,3-dicyclohexyl-2,4,6-trioxohexahydropyrimidin-5-yl)carbonyl]amino}acetic acid | IUPAC |
| GSK 1278863 | ChEBI |
| GSK-1278863 | DrugBank |
| GSK1278863 | DrugBank |
| Brand Name | Source |
|---|---|
| Jesduvroq | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| D10874 | KEGG DRUG |
| Daprodustat | Wikipedia |
| DB11682 | DrugBank |
| HMDB0250863 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:960539-70-2 | KEGG DRUG |
| Citations |
|---|