EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H14O7 |
| Net Charge | 0 |
| Average Mass | 330.292 |
| Monoisotopic Mass | 330.07395 |
| SMILES | COC(=O)C1=CC(=O)C=C(OC)C12Oc1cc(C)cc(O)c1C2=O |
| InChI | InChI=1S/C17H14O7/c1-8-4-11(19)14-12(5-8)24-17(15(14)20)10(16(21)23-3)6-9(18)7-13(17)22-2/h4-7,19H,1-3H3 |
| InChIKey | JCMPRFCVZKOFIT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bisdechlorogeodin (CHEBI:22899) has role antimicrobial agent (CHEBI:33281) |
| bisdechlorogeodin (CHEBI:22899) is a 1-benzofurans (CHEBI:38830) |
| bisdechlorogeodin (CHEBI:22899) is a cyclohexadiene (CHEBI:37613) |
| bisdechlorogeodin (CHEBI:22899) is a methyl ester (CHEBI:25248) |
| bisdechlorogeodin (CHEBI:22899) is a oxaspiro compound (CHEBI:37948) |
| Incoming Relation(s) |
| (+)-bisdechlorogeodin (CHEBI:15390) is a bisdechlorogeodin (CHEBI:22899) |
| (−)-bisdechlorogeodin (CHEBI:15391) is a bisdechlorogeodin (CHEBI:22899) |
| IUPAC Name |
|---|
| methyl 4-hydroxy-6-methyl-4'-oxo-3H-spiro[1-benzofuran-2,1'-cyclohexa[2,5]diene]-2'-carboxylate |
| Synonyms | Source |
|---|---|
| 4-hydroxy-6'-methoxy-6-methyl-3,4'-dioxo-spiro(benzofuran-2(3H),1'-(2,5)cyclohexadiene)-2'-carboxylic acid methyl ester | ChemIDplus |
| bis-dechlorogeodin | ChemIDplus |
| bisdechlorogeodin | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1299115 | Beilstein |
| CAS:3209-31-2 | ChemIDplus |