EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H14O7 |
| Net Charge | 0 |
| Average Mass | 330.292 |
| Monoisotopic Mass | 330.07395 |
| SMILES | COC(=O)C1=CC(=O)C=C(OC)[C@]12Oc1cc(C)cc(O)c1C2=O |
| InChI | InChI=1S/C17H14O7/c1-8-4-11(19)14-12(5-8)24-17(15(14)20)10(16(21)23-3)6-9(18)7-13(17)22-2/h4-7,19H,1-3H3/t17-/m1/s1 |
| InChIKey | JCMPRFCVZKOFIT-QGZVFWFLSA-N |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-bisdechlorogeodin (CHEBI:15391) is a bisdechlorogeodin (CHEBI:22899) |
| (−)-bisdechlorogeodin (CHEBI:15391) is enantiomer of (+)-bisdechlorogeodin (CHEBI:15390) |
| Incoming Relation(s) |
| (+)-bisdechlorogeodin (CHEBI:15390) is enantiomer of (−)-bisdechlorogeodin (CHEBI:15391) |
| IUPAC Name |
|---|
| methyl (2R)-4-hydroxy-6-methyl-4'-oxo-3H-spiro[1-benzofuran-2,1'-cyclohexa[2,5]diene]-2'-carboxylate |
| Synonym | Source |
|---|---|
| (-)-Bisdechlorogeodin | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| (2R)-bisdechlorogeodin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C03040 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:59187-35-8 | KEGG COMPOUND |