EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H12O3 |
| Net Charge | 0 |
| Average Mass | 192.214 |
| Monoisotopic Mass | 192.07864 |
| SMILES | CCCCC#Cc1ccc(C(=O)O)o1 |
| InChI | InChI=1S/C11H12O3/c1-2-3-4-5-6-9-7-8-10(14-9)11(12)13/h7-8H,2-4H2,1H3,(H,12,13) |
| InChIKey | LXFGRCRCBLJJTD-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | MetaboLights (MTBLS8662) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-hex-1-ynyl-2-furoic acid (CHEBI:228728) is a furoic acid (CHEBI:36055) |
| IUPAC Name |
|---|
| 5-hex-1-ynyluran-2-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 526759 | ChemSpider |