EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H36FN3O |
| Net Charge | 0 |
| Average Mass | 473.636 |
| Monoisotopic Mass | 473.28424 |
| SMILES | Cc1cn(C2=CCC3C4CC=C5C[C@@H](NC(=O)c6ccc(F)cc6)CC[C@]5(C)C4CC[C@]23C)cn1 |
| InChI | InChI=1S/C30H36FN3O/c1-19-17-34(18-32-19)27-11-10-25-24-9-6-21-16-23(33-28(35)20-4-7-22(31)8-5-20)12-14-29(21,2)26(24)13-15-30(25,27)3/h4-8,11,17-18,23-26H,9-10,12-16H2,1-3H3,(H,33,35)/t23-,24?,25?,26?,29-,30-/m0/s1 |
| InChIKey | JHVKBJJTUMIPIT-QQKFYDJZSA-N |
| Roles Classification |
|---|
| Biological Roles: | androgen antagonist A compound which inhibits or antagonises the biosynthesis or actions of androgens. EC 1.14.99.9 (steroid 17alpha-monooxygenase) inhibitor An EC 1.14.99.* (miscellaneous oxidoreductase acting on paired donors, with incorporation or reduction of molecular oxygen) inhibitor that interferes with the action of cytochrome P450 17-α-hydroxylase/C17,20-lyase (EC 1.14.99.9). |
| Applications: | androgen antagonist A compound which inhibits or antagonises the biosynthesis or actions of androgens. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| YXG-158 (CHEBI:228303) has role androgen antagonist (CHEBI:35497) |
| YXG-158 (CHEBI:228303) has role antineoplastic agent (CHEBI:35610) |
| YXG-158 (CHEBI:228303) has role EC 1.14.99.9 (steroid 17α-monooxygenase) inhibitor (CHEBI:68640) |
| YXG-158 (CHEBI:228303) is a androstane sterol (CHEBI:131640) |
| YXG-158 (CHEBI:228303) is a aza-steroid (CHEBI:35726) |
| YXG-158 (CHEBI:228303) is a benzamides (CHEBI:22702) |
| YXG-158 (CHEBI:228303) is a imidazoles (CHEBI:24780) |
| YXG-158 (CHEBI:228303) is a monofluorobenzenes (CHEBI:83575) |
| YXG-158 (CHEBI:228303) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| 4-fluoro-N-[(8ξ,9ξ,14ξ)-17-(4-methyl-1H-imidazol-1-yl)androsta-5,16-dien-3β-yl]benzamide |
| Synonyms | Source |
|---|---|
| YXG158 | ChEBI |
| YXG 158 | ChEBI |
| Citations |
|---|