EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H46O4 |
| Net Charge | 0 |
| Average Mass | 434.661 |
| Monoisotopic Mass | 434.33961 |
| SMILES | [H][C@]12C[C@@H](O)CC[C@]1(C)[C@@]1([H])CC[C@@]3(C)C4C1[C@]([H])(C2)OO[C@]4(O)C[C@]3([H])[C@H](C)CCCC(C)C |
| InChI | InChI=1S/C27H46O4/c1-16(2)7-6-8-17(3)21-15-27(29)24-23-20(10-12-26(21,24)5)25(4)11-9-19(28)13-18(25)14-22(23)30-31-27/h16-24,28-29H,6-15H2,1-5H3/t17-,18-,19+,20+,21-,22+,23?,24?,25+,26-,27-/m1/s1 |
| InChIKey | IQLCMZPBNGEATL-OJWVPMFBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Astropecten polyacanthus (ncbitaxon:60560) | - | PubMed (24088696) |
| Roles Classification |
|---|
| Chemical Role: | oxidising agent A substance that removes electrons from another reactant in a redox reaction. |
| Biological Roles: | marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| astropectenol B (CHEBI:228290) has role animal metabolite (CHEBI:75767) |
| astropectenol B (CHEBI:228290) has role marine metabolite (CHEBI:76507) |
| astropectenol B (CHEBI:228290) is a 15α-hydroxy steroid (CHEBI:83147) |
| astropectenol B (CHEBI:228290) is a 3β-hydroxy steroid (CHEBI:36836) |
| astropectenol B (CHEBI:228290) is a C27-steroid (CHEBI:131619) |
| astropectenol B (CHEBI:228290) is a organic peroxide (CHEBI:25702) |
| IUPAC Name |
|---|
| (1R,2aR,4aS,5aR,7S,9aS,9bS,11aR)-9a,11a-dimethyl-1-[(2R)-6-methylheptan-2-yl]hexadecahydro-2aH-3,4-dioxaindeno[6,7,1-mna]anthracene-2a,7-diol |
| Citations |
|---|