EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:228223 - (+)-SKF-10,047
| Formula | C17H23NO |
| Net Charge | 0 |
| Average Mass | 257.377 |
| Monoisotopic Mass | 257.17796 |
| SMILES | C=CCN1CC[C@]2(C)c3cc(O)ccc3C[C@H]1[C@H]2C |
| InChI | InChI=1S/C17H23NO/c1-4-8-18-9-7-17(3)12(2)16(18)10-13-5-6-14(19)11-15(13)17/h4-6,11-12,16,19H,1,7-10H2,2-3H3/t12-,16+,17+/m1/s1 |
| InChIKey | LGQCVMYAEFTEFN-DQYPLSBCSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | opioid receptor antagonist An agent that binds to but does not activate an opioid receptor thereby blocking the actions of endogenous or exogenous opioid receptor agonists. opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. |
| Applications: | sigma-1 receptor agonist A sigma receptor modulator that activates the sigma-1 receptor. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. opioid receptor antagonist An agent that binds to but does not activate an opioid receptor thereby blocking the actions of endogenous or exogenous opioid receptor agonists. opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-SKF-10,047 (CHEBI:228223) has role neuroprotective agent (CHEBI:63726) |
| (+)-SKF-10,047 (CHEBI:228223) has role sigma-1 receptor agonist (CHEBI:228237) |
| (+)-SKF-10,047 (CHEBI:228223) is a SKF-10,047 (CHEBI:228203) |
| IUPAC Name |
|---|
| (2S,6S,11S)-6,11-dimethyl-3-(prop-2-en-1-yl)-1,2,3,4,5,6-hexahydro-2,6-methano-3-benzazocin-8-ol |
| Synonyms | Source |
|---|---|
| (+)SKF 10,047 | ChEBI |
| d-N-allylnormetazocine | ChEBI |
| (+)-SKF 10,047 | ChEBI |
| d-SKF 10047 | ChEBI |
| (+)-SKF 10047 | ChEBI |
| (+)-N-allylnormetazocine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:58640-82-7 | ChEBI |
| Citations |
|---|