EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H23NO |
| Net Charge | 0 |
| Average Mass | 257.377 |
| Monoisotopic Mass | 257.17796 |
| SMILES | C=CCN1CCC2(C)c3cc(O)ccc3CC1C2C |
| InChI | InChI=1S/C17H23NO/c1-4-8-18-9-7-17(3)12(2)16(18)10-13-5-6-14(19)11-15(13)17/h4-6,11-12,16,19H,1,7-10H2,2-3H3 |
| InChIKey | LGQCVMYAEFTEFN-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | opioid receptor antagonist An agent that binds to but does not activate an opioid receptor thereby blocking the actions of endogenous or exogenous opioid receptor agonists. opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. |
| Applications: | opioid receptor antagonist An agent that binds to but does not activate an opioid receptor thereby blocking the actions of endogenous or exogenous opioid receptor agonists. opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| SKF-10,047 (CHEBI:228203) has role opioid analgesic (CHEBI:35482) |
| SKF-10,047 (CHEBI:228203) has role opioid receptor antagonist (CHEBI:60605) |
| SKF-10,047 (CHEBI:228203) is a olefinic compound (CHEBI:78840) |
| SKF-10,047 (CHEBI:228203) is a organic heterotricyclic compound (CHEBI:26979) |
| SKF-10,047 (CHEBI:228203) is a organic hydroxy compound (CHEBI:33822) |
| SKF-10,047 (CHEBI:228203) is a tertiary amino compound (CHEBI:50996) |
| Incoming Relation(s) |
| (+)-SKF-10,047 (CHEBI:228223) is a SKF-10,047 (CHEBI:228203) |
| (−)-SKF-10,047 (CHEBI:228224) is a SKF-10,047 (CHEBI:228203) |
| IUPAC Name |
|---|
| 6,11-dimethyl-3-(prop-2-en-1-yl)-1,2,3,4,5,6-hexahydro-2,6-methano-3-benzazocin-8-ol |
| Synonyms | Source |
|---|---|
| alazocine | ChEBI |
| N-allylnormetazocine | ChEBI |
| NANM | ChEBI |
| SKF 10,047 | ChEBI |
| SKF 10047 | ChEBI |
| SKF-10047 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Alazocine | Wikipedia |
| HMDB0244608 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:825594-24-9 | ChEBI |
| Citations |
|---|