EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H23NO |
| Net Charge | 0 |
| Average Mass | 257.377 |
| Monoisotopic Mass | 257.17796 |
| SMILES | C=CCN1CCC2(C)c3cc(O)ccc3CC1C2C |
| InChI | InChI=1S/C17H23NO/c1-4-8-18-9-7-17(3)12(2)16(18)10-13-5-6-14(19)11-15(13)17/h4-6,11-12,16,19H,1,7-10H2,2-3H3 |
| InChIKey | LGQCVMYAEFTEFN-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. opioid receptor antagonist An agent that binds to but does not activate an opioid receptor thereby blocking the actions of endogenous or exogenous opioid receptor agonists. |
| Applications: | opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. opioid receptor antagonist An agent that binds to but does not activate an opioid receptor thereby blocking the actions of endogenous or exogenous opioid receptor agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| SKF-10,047 (CHEBI:228203) has role opioid analgesic (CHEBI:35482) |
| SKF-10,047 (CHEBI:228203) has role opioid receptor antagonist (CHEBI:60605) |
| SKF-10,047 (CHEBI:228203) is a olefinic compound (CHEBI:78840) |
| SKF-10,047 (CHEBI:228203) is a organic heterotricyclic compound (CHEBI:26979) |
| SKF-10,047 (CHEBI:228203) is a organic hydroxy compound (CHEBI:33822) |
| SKF-10,047 (CHEBI:228203) is a tertiary amino compound (CHEBI:50996) |
| Incoming Relation(s) |
| (+)-SKF-10,047 (CHEBI:228223) is a SKF-10,047 (CHEBI:228203) |
| (−)-SKF-10,047 (CHEBI:228224) is a SKF-10,047 (CHEBI:228203) |
| IUPAC Name |
|---|
| 6,11-dimethyl-3-(prop-2-en-1-yl)-1,2,3,4,5,6-hexahydro-2,6-methano-3-benzazocin-8-ol |
| Synonyms | Source |
|---|---|
| alazocine | ChEBI |
| N-allylnormetazocine | ChEBI |
| NANM | ChEBI |
| SKF 10,047 | ChEBI |
| SKF 10047 | ChEBI |
| SKF-10047 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Alazocine | Wikipedia |
| HMDB0244608 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:825594-24-9 | ChEBI |
| Citations |
|---|