EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H14O5 |
| Net Charge | 0 |
| Average Mass | 250.250 |
| Monoisotopic Mass | 250.08412 |
| SMILES | CC1=CC(=O)C[C@H](Cc2cc(C)c(C(=O)O)o2)O1 |
| InChI | InChI=1S/C13H14O5/c1-7-3-10(18-12(7)13(15)16)6-11-5-9(14)4-8(2)17-11/h3-4,11H,5-6H2,1-2H3,(H,15,16)/t11-/m1/s1 |
| InChIKey | ADMPDLBGVMALKU-LLVKDONJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium (ncbitaxon:5073) | - | DOI (10.1016/j.phytol.2015.10.016) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-methyl-5-[(6-methyl-4-oxo-2,3-dihydropyran-2-yl)methyl]uran-2-carboxylic acid (CHEBI:228042) is a furoic acid (CHEBI:36055) |
| IUPAC Name |
|---|
| 3-methyl-5-[(6-methyl-4-oxo-2,3-dihydropyran-2-yl)methyl]uran-2-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 58197237 | ChemSpider |