EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H29ClO7 |
| Net Charge | 0 |
| Average Mass | 416.898 |
| Monoisotopic Mass | 416.16018 |
| SMILES | CCC(C)C(O)C(C)(O)C(O)/C=C/C1=CC2=C(Cl)C(=O)[C@](C)(O)[C@H](O)C2CO1 |
| InChI | InChI=1S/C20H29ClO7/c1-5-10(2)16(23)19(3,26)14(22)7-6-11-8-12-13(9-28-11)17(24)20(4,27)18(25)15(12)21/h6-8,10,13-14,16-17,22-24,26-27H,5,9H2,1-4H3/b7-6+/t10?,13?,14?,16?,17-,19?,20-/m1/s1 |
| InChIKey | TZYUJRSJKZJSDF-AZYXQUOMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium (ncbitaxon:5073) | - | PubMed (27605109) |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Penicilazaphilone C (CHEBI:227990) is a azaphilone (CHEBI:50941) |
| IUPAC Name |
|---|
| (7R,8R)-5-chloro-7,8-dihydroxy-7-methyl-3-[(E)-3,4,5-trihydroxy-4,6-dimethyloct-1-enyl]-8,8a-dihydro-1H-isochromen-6-one |
| Manual Xrefs | Databases |
|---|---|
| 60597186 | ChemSpider |