EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H33ClO6 |
| Net Charge | 0 |
| Average Mass | 440.964 |
| Monoisotopic Mass | 440.19657 |
| SMILES | CCC[C@@H]1O[C@H](C(C)CC)[C@@](C)(/C=C/C2=CC3=C(Cl)C(=O)[C@](C)(O)[C@H](O)[C@@H]3CO2)O1 |
| InChI | InChI=1S/C23H33ClO6/c1-6-8-17-29-21(13(3)7-2)22(4,30-17)10-9-14-11-15-16(12-28-14)19(25)23(5,27)20(26)18(15)24/h9-11,13,16-17,19,21,25,27H,6-8,12H2,1-5H3/b10-9+/t13?,16-,17-,19-,21-,22-,23-/m1/s1 |
| InChIKey | MJRWETKDUIEFRG-PHVAZZQJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicilliumspecies (ncbitaxon:5081) | - | DOI (10.20307/nps.2015.21.4.231) |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Penidioxolane A (CHEBI:227723) is a azaphilone (CHEBI:50941) |
| IUPAC Name |
|---|
| (7R,8R,8aS)-3-[(E)-2-[(2R,4R,5R)-5-butan-2-yl-4-methyl-2-propyl-1,3-dioxolan-4-yl]ethenyl]-5-chloro-7,8-dihydroxy-7-methyl-8,8a-dihydro-1H-isochromen-6-one |
| Manual Xrefs | Databases |
|---|---|
| 44210897 | ChemSpider |