EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H11ClO4 |
| Net Charge | 0 |
| Average Mass | 242.658 |
| Monoisotopic Mass | 242.03459 |
| SMILES | CC1=CC2=C(Cl)C(=O)C(C)(O)C(O)C2=CO1 |
| InChI | InChI=1S/C11H11ClO4/c1-5-3-6-7(4-16-5)9(13)11(2,15)10(14)8(6)12/h3-4,9,13,15H,1-2H3 |
| InChIKey | VXWRVCGJKGEDNF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Myxotrichumspecies (ncbitaxon:1921597) | - | DOI (10.1016/j.phytol.2013.08.011) |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Myxodiol A (CHEBI:227688) is a azaphilone (CHEBI:50941) |
| IUPAC Name |
|---|
| 5-chloro-7,8-dihydroxy-3,7-dimethyl-8H-isochromen-6-one |
| Manual Xrefs | Databases |
|---|---|
| 78435684 | ChemSpider |