EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:22660 - aspartic acid
| Formula | C4H7NO4 |
| Net Charge | 0 |
| Average Mass | 133.103 |
| Monoisotopic Mass | 133.03751 |
| SMILES | NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C4H7NO4/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H,6,7)(H,8,9) |
| InChIKey | CKLJMWTZIZZHCS-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Daphnia magna (ncbitaxon:35525) | - | Article (Mixtures of similarly acting compounds in Daphnia magna: From gene to metabolite and beyondTine Vandenbrouck, Oliver A.H. Jones, Nathalie Dom, Julian L. Griffin, Wim De CoenEnvironment International 36 (2010) 254-268) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | fundamental metabolite Any metabolite produced by all living cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aspartic acid (CHEBI:22660) has part carboxymethyl group (CHEBI:41402) |
| aspartic acid (CHEBI:22660) has role fundamental metabolite (CHEBI:78675) |
| aspartic acid (CHEBI:22660) is a C4-dicarboxylic acid (CHEBI:66873) |
| aspartic acid (CHEBI:22660) is a polar amino acid (CHEBI:26167) |
| aspartic acid (CHEBI:22660) is a α-amino acid (CHEBI:33704) |
| aspartic acid (CHEBI:22660) is conjugate acid of aspartate (CHEBI:132943) |
| aspartic acid (CHEBI:22660) is conjugate acid of aspartate(1−) (CHEBI:35391) |
| Incoming Relation(s) |
| α-Asp-Leu (CHEBI:68596) has functional parent aspartic acid (CHEBI:22660) |
| β-Asp-Ile (CHEBI:68601) has functional parent aspartic acid (CHEBI:22660) |
| β-Asp-Leu (CHEBI:68600) has functional parent aspartic acid (CHEBI:22660) |
| D-aspartic acid (CHEBI:17364) is a aspartic acid (CHEBI:22660) |
| L-aspartic acid (CHEBI:17053) is a aspartic acid (CHEBI:22660) |
| aspartic acid-1,4-13C2 (CHEBI:176633) is a aspartic acid (CHEBI:22660) |
| aspartate (CHEBI:132943) is conjugate base of aspartic acid (CHEBI:22660) |
| aspartate(1−) (CHEBI:35391) is conjugate base of aspartic acid (CHEBI:22660) |
| aspartic acid residue (CHEBI:32470) is substituent group from aspartic acid (CHEBI:22660) |
| asparto group (CHEBI:22662) is substituent group from aspartic acid (CHEBI:22660) |
| aspartoyl group (CHEBI:22663) is substituent group from aspartic acid (CHEBI:22660) |
| α-aspartyl group (CHEBI:22445) is substituent group from aspartic acid (CHEBI:22660) |
| β-aspartyl group (CHEBI:22832) is substituent group from aspartic acid (CHEBI:22660) |
| IUPAC Name |
|---|
| aspartic acid |
| Synonyms | Source |
|---|---|
| 2-aminobutanedioic acid | IUPAC |
| Asp | ChEBI |
| (+-)-Aspartic acid | ChemIDplus |
| Aspartic acid | KEGG COMPOUND |
| D | ChEBI |
| DL-Aminosuccinic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Aspartic_acid | Wikipedia |
| C16433 | KEGG COMPOUND |
| Citations |
|---|