EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H7NO4 |
| Net Charge | 0 |
| Average Mass | 133.103 |
| Monoisotopic Mass | 133.03751 |
| SMILES | N[C@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C4H7NO4/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H,6,7)(H,8,9)/t2-/m1/s1 |
| InChIKey | CKLJMWTZIZZHCS-UWTATZPHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | - | PubMed (18318836) | |
| Homo sapiens (ncbitaxon:9606) | - | PubMed (19860889) | |
| Mus musculus (ncbitaxon:10090) | |||
| - | PubMed (11419736) | ||
| - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). fundamental metabolite Any metabolite produced by all living cells. |
| Applications: | immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-aspartic acid (CHEBI:17364) has role immunosuppressive agent (CHEBI:35705) |
| D-aspartic acid (CHEBI:17364) has role mouse metabolite (CHEBI:75771) |
| D-aspartic acid (CHEBI:17364) has role neuroprotective agent (CHEBI:63726) |
| D-aspartic acid (CHEBI:17364) is a D-α-amino acid (CHEBI:16733) |
| D-aspartic acid (CHEBI:17364) is a aspartic acid (CHEBI:22660) |
| D-aspartic acid (CHEBI:17364) is conjugate acid of D-aspartate(1−) (CHEBI:29990) |
| D-aspartic acid (CHEBI:17364) is enantiomer of L-aspartic acid (CHEBI:17053) |
| Incoming Relation(s) |
| D-aspartic acid derivative (CHEBI:83979) has functional parent D-aspartic acid (CHEBI:17364) |
| L-Lys-D-Asp (CHEBI:144741) has functional parent D-aspartic acid (CHEBI:17364) |
| L-Orn-D-Asp (CHEBI:144746) has functional parent D-aspartic acid (CHEBI:17364) |
| D-aspartate(1−) (CHEBI:29990) is conjugate base of D-aspartic acid (CHEBI:17364) |
| L-aspartic acid (CHEBI:17053) is enantiomer of D-aspartic acid (CHEBI:17364) |
| D-aspartic acid residue (CHEBI:48094) is substituent group from D-aspartic acid (CHEBI:17364) |
| D-aspartoyl group (CHEBI:32468) is substituent group from D-aspartic acid (CHEBI:17364) |
| IUPAC Names |
|---|
| (2R)-2-aminobutanedioic acid |
| D-aspartic acid |
| Synonyms | Source |
|---|---|
| aspartic acid D-form | ChemIDplus |
| DAS | PDBeChem |
| d-aspartate | ChEMBL |
| D-Aspartic acid | KEGG COMPOUND |
| (R)-2-aminobutanedioic acid | ChEBI |
| (R)-2-aminosuccinic acid | ChEBI |
| Citations |
|---|