EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:17364 - D-aspartic acid
| Formula | C4H7NO4 |
| Net Charge | 0 |
| Average Mass | 133.103 |
| Monoisotopic Mass | 133.03751 |
| SMILES | N[C@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C4H7NO4/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H,6,7)(H,8,9)/t2-/m1/s1 |
| InChIKey | CKLJMWTZIZZHCS-UWTATZPHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | - | PubMed (18318836) | |
| Homo sapiens (ncbitaxon:9606) | - | PubMed (19860889) | |
| Mus musculus (ncbitaxon:10090) | |||
| - | PubMed (11419736) | ||
| - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. fundamental metabolite Any metabolite produced by all living cells. |
| Applications: | neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-aspartic acid (CHEBI:17364) has role immunosuppressive agent (CHEBI:35705) |
| D-aspartic acid (CHEBI:17364) has role mouse metabolite (CHEBI:75771) |
| D-aspartic acid (CHEBI:17364) has role neuroprotective agent (CHEBI:63726) |
| D-aspartic acid (CHEBI:17364) is a D-α-amino acid (CHEBI:16733) |
| D-aspartic acid (CHEBI:17364) is a aspartic acid (CHEBI:22660) |
| D-aspartic acid (CHEBI:17364) is conjugate acid of D-aspartate(1−) (CHEBI:29990) |
| D-aspartic acid (CHEBI:17364) is enantiomer of L-aspartic acid (CHEBI:17053) |
| Incoming Relation(s) |
| D-aspartic acid derivative (CHEBI:83979) has functional parent D-aspartic acid (CHEBI:17364) |
| L-Lys-D-Asp (CHEBI:144741) has functional parent D-aspartic acid (CHEBI:17364) |
| L-Orn-D-Asp (CHEBI:144746) has functional parent D-aspartic acid (CHEBI:17364) |
| D-aspartate(1−) (CHEBI:29990) is conjugate base of D-aspartic acid (CHEBI:17364) |
| L-aspartic acid (CHEBI:17053) is enantiomer of D-aspartic acid (CHEBI:17364) |
| D-aspartic acid residue (CHEBI:48094) is substituent group from D-aspartic acid (CHEBI:17364) |
| D-aspartoyl group (CHEBI:32468) is substituent group from D-aspartic acid (CHEBI:17364) |
| IUPAC Names |
|---|
| (2R)-2-aminobutanedioic acid |
| D-aspartic acid |
| Synonyms | Source |
|---|---|
| aspartic acid D-form | ChemIDplus |
| DAS | PDBeChem |
| d-aspartate | ChEMBL |
| D-Aspartic acid | KEGG COMPOUND |
| (R)-2-aminobutanedioic acid | ChEBI |
| (R)-2-aminosuccinic acid | ChEBI |
| Citations |
|---|