EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H22ClNO4 |
| Net Charge | 0 |
| Average Mass | 351.830 |
| Monoisotopic Mass | 351.12374 |
| SMILES | CC[C@H](C)/C=C/C1=CC2=C(Cl)C(=O)[C@@](C)(O)C(=O)C2=CN1CCO |
| InChI | InChI=1S/C18H22ClNO4/c1-4-11(2)5-6-12-9-13-14(10-20(12)7-8-21)16(22)18(3,24)17(23)15(13)19/h5-6,9-11,21,24H,4,7-8H2,1-3H3/b6-5+/t11-,18-/m0/s1 |
| InChIKey | UBEZPANUWOHMOG-RNMACCOLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chaetomium (ncbitaxon:5149) | - | DOI (10.1016/j.tetlet.2012.11.084) |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Isochromophilone XIII (CHEBI:225686) is a azaphilone (CHEBI:50941) |
| IUPAC Name |
|---|
| (7S)-5-chloro-7-hydroxy-2-(2-hydroxyethyl)-7-methyl-3-[(E,3S)-3-methylpent-1-enyl]isoquinoline-6,8-dione |
| Manual Xrefs | Databases |
|---|---|
| 78442741 | ChemSpider |