EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H22O5 |
| Net Charge | 0 |
| Average Mass | 282.336 |
| Monoisotopic Mass | 282.14672 |
| SMILES | [H][C@]12OC(=O)[C@H](C)[C@]3([H])CC[C@@H](C)[C@]4([H])CC[C@@](C)(OO[C@]143)O2 |
| InChI | InChI=1S/C15H22O5/c1-8-4-5-11-9(2)12(16)17-13-15(11)10(8)6-7-14(3,18-13)19-20-15/h8-11,13H,4-7H2,1-3H3/t8-,9-,10+,11+,13-,14-,15-/m1/s1 |
| InChIKey | BLUAFEHZUWYNDE-NNWCWBAJSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | oxidising agent A substance that removes electrons from another reactant in a redox reaction. |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| Application: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-artemisinin (CHEBI:223316) has role antimalarial (CHEBI:38068) |
| (+)-artemisinin (CHEBI:223316) has role plant metabolite (CHEBI:76924) |
| (+)-artemisinin (CHEBI:223316) is a organic peroxide (CHEBI:25702) |
| (+)-artemisinin (CHEBI:223316) is a sesquiterpene lactone (CHEBI:37667) |
| Incoming Relation(s) |
| artemisinin derivative (CHEBI:63920) has functional parent (+)-artemisinin (CHEBI:223316) |
| IUPAC Name |
|---|
| (3R,5aS,6R,8aS,9R,12S,12aR)-3,6,9-trimethyloctahydro-3,12-epoxypyrano[4,3-j][1,2]benzodioxepin-10(3H)-one |
| INNs | Source |
|---|---|
| artemisinin | ChemIDplus |
| artemisininum | ChemIDplus |
| Synonyms | Source |
|---|---|
| Quing Hau Sau | KEGG COMPOUND |
| 1,5,9-trimethyl-(1R,4S,5R,9R,12S,13R)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-one | ChEMBL |
| Qing Hau Sau | KEGG DRUG |
| artemisinine | ChemIDplus |
| arteannuin | ChemIDplus |
| artemisinina | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D02481 | KEGG DRUG |
| C09538 | KEGG COMPOUND |
| LMPR0103190003 | LIPID MAPS |
| Artemisinin | Wikipedia |
| CPD-7561 | MetaCyc |
| C00003359 | KNApSAcK |
| LSM-6546 | LINCS |
| 3871 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Gmelin:1755493 | Gmelin |
| Reaxys:4194670 | Reaxys |
| CAS:63968-64-9 | KEGG DRUG |
| CAS:63968-64-9 | KEGG COMPOUND |
| CAS:63968-64-9 | ChemIDplus |
| CAS:63968-64-9 | NIST Chemistry WebBook |
| Citations |
|---|