EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H22O5 |
| Net Charge | 0 |
| Average Mass | 282.336 |
| Monoisotopic Mass | 282.14672 |
| SMILES | [H][C@]12OC(=O)[C@H](C)[C@]3([H])CC[C@@H](C)[C@]4([H])CC[C@@](C)(OO[C@]143)O2 |
| InChI | InChI=1S/C15H22O5/c1-8-4-5-11-9(2)12(16)17-13-15(11)10(8)6-7-14(3,18-13)19-20-15/h8-11,13H,4-7H2,1-3H3/t8-,9-,10+,11+,13-,14-,15-/m1/s1 |
| InChIKey | BLUAFEHZUWYNDE-NNWCWBAJSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | oxidising agent A substance that removes electrons from another reactant in a redox reaction. |
| Biological Roles: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-artemisinin (CHEBI:223316) has role antimalarial (CHEBI:38068) |
| (+)-artemisinin (CHEBI:223316) has role plant metabolite (CHEBI:76924) |
| (+)-artemisinin (CHEBI:223316) is a organic peroxide (CHEBI:25702) |
| (+)-artemisinin (CHEBI:223316) is a sesquiterpene lactone (CHEBI:37667) |
| Incoming Relation(s) |
| artemisinin derivative (CHEBI:63920) has functional parent (+)-artemisinin (CHEBI:223316) |
| IUPAC Name |
|---|
| (3R,5aS,6R,8aS,9R,12S,12aR)-3,6,9-trimethyloctahydro-3,12-epoxypyrano[4,3-j][1,2]benzodioxepin-10(3H)-one |
| INNs | Source |
|---|---|
| artemisinin | ChemIDplus |
| artemisininum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1,5,9-trimethyl-(1R,4S,5R,9R,12S,13R)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-one | ChEMBL |
| arteannuin | ChemIDplus |
| artemisinina | ChemIDplus |
| artemisinine | ChemIDplus |
| huanghuahaosu | ChEBI |
| Octahydro-3,6,9-trimethyl-3,12-epoxy-12H-pyrano(4,3-j)-1,2-benzodioxepin-10(3H)-one | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 3871 | DrugCentral |
| Artemisinin | Wikipedia |
| C00003359 | KNApSAcK |
| C09538 | KEGG COMPOUND |
| CPD-7561 | MetaCyc |
| D02481 | KEGG DRUG |
| LMPR0103190003 | LIPID MAPS |
| LSM-6546 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Gmelin:1755493 | Gmelin |
| Reaxys:4194670 | Reaxys |
| CAS:63968-64-9 | KEGG DRUG |
| CAS:63968-64-9 | NIST Chemistry WebBook |
| CAS:63968-64-9 | ChemIDplus |
| CAS:63968-64-9 | KEGG COMPOUND |
| Citations |
|---|