EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H35BrO7 |
| Net Charge | 0 |
| Average Mass | 575.496 |
| Monoisotopic Mass | 574.15662 |
| SMILES | CCCCCC[C@H](C)/C=C(\C)C(=O)O[C@]1(C)C(=O)C2=COC(C3=C(C)C[C@@H](O)CC3=O)=CC2=C(Br)C1=O |
| InChI | InChI=1S/C29H35BrO7/c1-6-7-8-9-10-16(2)11-18(4)28(35)37-29(5)26(33)21-15-36-23(14-20(21)25(30)27(29)34)24-17(3)12-19(31)13-22(24)32/h11,14-16,19,31H,6-10,12-13H2,1-5H3/b18-11+/t16-,19+,29+/m0/s1 |
| InChIKey | VJHUSRCFHWWYCT-LWGLPVJESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium (ncbitaxon:5073) | - | PubMed (30693772) |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Penicilone G (CHEBI:222958) is a azaphilone (CHEBI:50941) |
| IUPAC Name |
|---|
| [(7R)-5-bromo-3-[(4R)-4-hydroxy-2-methyl-6-oxocyclohexen-1-yl]-7-methyl-6,8-dioxoisochromen-7-yl] (E,4S)-2,4-dimethyldec-2-enoate |
| Manual Xrefs | Databases |
|---|---|
| 71120871 | ChemSpider |