EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H8O4 |
| Net Charge | -2 |
| Average Mass | 144.126 |
| Monoisotopic Mass | 144.04336 |
| SMILES | O=C([O-])CCCCC(=O)[O-] |
| InChI | InChI=1S/C6H10O4/c7-5(8)3-1-2-4-6(9)10/h1-4H2,(H,7,8)(H,9,10)/p-2 |
| InChIKey | WNLRTRBMVRJNCN-UHFFFAOYSA-L |
| Roles Classification |
|---|
| Biological Role: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| adipate(2−) (CHEBI:17128) has role human xenobiotic metabolite (CHEBI:76967) |
| adipate(2−) (CHEBI:17128) is a saturated dicarboxylic acid dianion(2−) (CHEBI:133291) |
| adipate(2−) (CHEBI:17128) is conjugate base of adipate(1−) (CHEBI:30833) |
| Incoming Relation(s) |
| L-2-aminoadipate(2−) (CHEBI:17082) has functional parent adipate(2−) (CHEBI:17128) |
| 2,4-dichloro-3-oxoadipate(2−) (CHEBI:19345) has functional parent adipate(2−) (CHEBI:17128) |
| 3-oxoadipate(2−) (CHEBI:15775) has functional parent adipate(2−) (CHEBI:17128) |
| mono-2-(ethylhexyl) adipate (CHEBI:233709) has functional parent adipate(2−) (CHEBI:17128) |
| piperazine adipate (CHEBI:133924) has part adipate(2−) (CHEBI:17128) |
| adipate(1−) (CHEBI:30833) is conjugate acid of adipate(2−) (CHEBI:17128) |
| IUPAC Name |
|---|
| hexanedioate |
| Synonyms | Source |
|---|---|
| adipate dianion | ChemIDplus |
| hexan-1,6-dicarboxylate | ChEBI |
| hexanedioic acid, ion(2−) | ChemIDplus |
| O2C(CH2)4CO2 dianion | NIST Chemistry WebBook |
| UniProt Name | Source |
|---|---|
| hexanedioate | UniProt |