EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H4Cl2O5 |
| Net Charge | -2 |
| Average Mass | 226.999 |
| Monoisotopic Mass | 225.94468 |
| SMILES | O=C([O-])CC(Cl)C(=O)C(Cl)C(=O)[O-] |
| InChI | InChI=1S/C6H6Cl2O5/c7-2(1-3(9)10)5(11)4(8)6(12)13/h2,4H,1H2,(H,9,10)(H,12,13)/p-2 |
| InChIKey | PWUASGXACKVWSY-UHFFFAOYSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,4-dichloro-3-oxoadipate(2−) (CHEBI:19345) has functional parent adipate(2−) (CHEBI:17128) |
| 2,4-dichloro-3-oxoadipate(2−) (CHEBI:19345) is a oxo dicarboxylate (CHEBI:36147) |
| 2,4-dichloro-3-oxoadipate(2−) (CHEBI:19345) is conjugate base of 2,4-dichloro-3-oxoadipic acid (CHEBI:177909) |
| Incoming Relation(s) |
| 2,4-dichloro-3-oxoadipic acid (CHEBI:177909) is conjugate acid of 2,4-dichloro-3-oxoadipate(2−) (CHEBI:19345) |
| IUPAC Name |
|---|
| 2,4-dichloro-3-oxohexanedioate |
| Synonyms | Source |
|---|---|
| 2,4-dichloro-3-keto-adipate | ChEBI |
| 2,4-dichloro-3-oxoadipate | KEGG COMPOUND |
| 2,4-dichloro-3-oxoadipic acid dianion | ChEBI |