EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:133924 - piperazine adipate
| Formula | C4H10N2.C6H10O4 |
| Net Charge | 0 |
| Average Mass | 232.280 |
| Monoisotopic Mass | 232.14231 |
| SMILES | C1CNCCN1.O=C(O)CCCCC(=O)O |
| InChI | InChI=1S/C6H10O4.C4H10N2/c7-5(8)3-1-2-4-6(9)10;1-2-6-4-3-5-1/h1-4H2,(H,7,8)(H,9,10);5-6H,1-4H2 |
| InChIKey | BVEGEKOBSPXUJS-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Apis cerana (ncbitaxon:7461) | - | MetaboLights (MTBLS379) |
| Roles Classification |
|---|
| Applications: | antinematodal drug A substance used in the treatment or control of nematode infestations. anthelminthic drug Substance intended to kill parasitic worms (helminths). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| piperazine adipate (CHEBI:133924) has part adipate(2−) (CHEBI:17128) |
| piperazine adipate (CHEBI:133924) has part piperazinium(2+) (CHEBI:136874) |
| piperazine adipate (CHEBI:133924) has role anthelminthic drug (CHEBI:35443) |
| piperazine adipate (CHEBI:133924) has role antinematodal drug (CHEBI:35444) |
| piperazine adipate (CHEBI:133924) is a piperazinium salt (CHEBI:46849) |
| IUPAC Names |
|---|
| hexanedioic acid—piperazine (1/1) |
| piperazine-1,4-diium hexanedioate |
| Synonyms | Source |
|---|---|
| hexanedioic acid - piperazine (1:1) | ChEBI |
| piperazinium hexanedioate | ChEBI |
| piperazinium adipate | ChEBI |
| Citations |
|---|