EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H26O8 |
| Net Charge | 0 |
| Average Mass | 430.453 |
| Monoisotopic Mass | 430.16277 |
| SMILES | C/C=C/C=C/C=C/C1=CC2=CC(=O)C(C)(OC(=O)CC(O)CC(C)O)C(=O)C23OC3O1 |
| InChI | InChI=1S/C23H26O8/c1-4-5-6-7-8-9-17-11-15-12-18(26)22(3,20(28)23(15)21(29-17)31-23)30-19(27)13-16(25)10-14(2)24/h4-9,11-12,14,16,21,24-25H,10,13H2,1-3H3/b5-4+,7-6+,9-8+ |
| InChIKey | GWWPRBVUUXKASM-ZAJAATJQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium urticae (ncbitaxon:29844) | - | PubMed (7868395) |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Patulodin (CHEBI:220680) is a azaphilone (CHEBI:50941) |
| IUPAC Name |
|---|
| [3-[(1E,3E,5E)-hepta-1,3,5-trienyl]-7-methyl-6,8-dioxo-1aH-oxireno[2,3-j]isochromen-7-yl] 3,5-dihydroxyhexanoate |
| Manual Xrefs | Databases |
|---|---|
| 8653195 | ChemSpider |