EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H26O6 |
| Net Charge | 0 |
| Average Mass | 386.444 |
| Monoisotopic Mass | 386.17294 |
| SMILES | CO[C@@H](C)[C@H](/C=C/C=C/c1cccc(O)c1C(=O)O)C(=O)/C(C)=C/C1OC1C |
| InChI | InChI=1S/C22H26O6/c1-13(12-19-15(3)28-19)21(24)17(14(2)27-4)10-6-5-8-16-9-7-11-18(23)20(16)22(25)26/h5-12,14-15,17,19,23H,1-4H3,(H,25,26)/b8-5+,10-6+,13-12+/t14-,15?,17-,19?/m0/s1 |
| InChIKey | WNSZZRDXVFFVPW-IDOQMONCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomycesspecies C39 (ncbitaxon:295100) | - | PubMed (10604763) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Gibbestatin B (CHEBI:220560) has functional parent salicylic acid (CHEBI:16914) |
| Gibbestatin B (CHEBI:220560) is a hydroxybenzoic acid (CHEBI:24676) |
| IUPAC Name |
|---|
| 2-hydroxy-6-[(1E,3E,5S,7E)-5-[(1S)-1-methoxyethyl]-7-methyl-8-(3-methyloxiran-2-yl)-6-oxoocta-1,3,7-trienyl]benzoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78438743 | ChemSpider |