EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H16O4 |
| Net Charge | 0 |
| Average Mass | 212.245 |
| Monoisotopic Mass | 212.10486 |
| SMILES | CC(C)CCc1occ(CO)c1C(=O)O |
| InChI | InChI=1S/C11H16O4/c1-7(2)3-4-9-10(11(13)14)8(5-12)6-15-9/h6-7,12H,3-5H2,1-2H3,(H,13,14) |
| InChIKey | WCDZGGPOMQMYJJ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (18988741) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-(hydroxymethyl)-2-(3-methylbutyl)uran-3-carboxylic acid (CHEBI:220495) is a furoic acid (CHEBI:36055) |
| IUPAC Name |
|---|
| 4-(hydroxymethyl)-2-(3-methylbutyl)uran-3-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 60804314 | ChemSpider |