EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:28229 - Nω-methyl-L-arginine
| Formula | C7H16N4O2 |
| Net Charge | 0 |
| Average Mass | 188.231 |
| Monoisotopic Mass | 188.12733 |
| SMILES | CNC(=N)NCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C7H16N4O2/c1-10-7(9)11-4-2-3-5(8)6(12)13/h5H,2-4,8H2,1H3,(H,12,13)(H3,9,10,11)/t5-/m0/s1 |
| InChIKey | NTNWOCRCBQPEKQ-YFKPBYRVSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. |
| Applications: | anticholesteremic drug A substance used to lower plasma cholesterol levels. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. anti-anaemic agent A compound which increases either the number of red cells or the amount of haemoglobin in the blood. hepatoprotective agent Any compound that is able to prevent damage to the liver. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nω-methyl-L-arginine (CHEBI:28229) has role anti-anaemic agent (CHEBI:75835) |
| Nω-methyl-L-arginine (CHEBI:28229) has role anti-HIV agent (CHEBI:64946) |
| Nω-methyl-L-arginine (CHEBI:28229) has role anticholesteremic drug (CHEBI:35821) |
| Nω-methyl-L-arginine (CHEBI:28229) has role antihypertensive agent (CHEBI:35674) |
| Nω-methyl-L-arginine (CHEBI:28229) has role antineoplastic agent (CHEBI:35610) |
| Nω-methyl-L-arginine (CHEBI:28229) has role cardiovascular drug (CHEBI:35554) |
| Nω-methyl-L-arginine (CHEBI:28229) has role hepatoprotective agent (CHEBI:62868) |
| Nω-methyl-L-arginine (CHEBI:28229) is a L-arginine derivative (CHEBI:83965) |
| Nω-methyl-L-arginine (CHEBI:28229) is a guanidines (CHEBI:24436) |
| Nω-methyl-L-arginine (CHEBI:28229) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| Nω-methyl-L-arginine (CHEBI:28229) is conjugate acid of Nω-methyl-L-argininate (CHEBI:67015) |
| Nω-methyl-L-arginine (CHEBI:28229) is tautomer of Nω-methyl-L-arginine zwitterion (CHEBI:60257) |
| Incoming Relation(s) |
| Nω-methyl-L-argininate (CHEBI:67015) is conjugate base of Nω-methyl-L-arginine (CHEBI:28229) |
| Nω-methyl-L-arginine zwitterion (CHEBI:60257) is tautomer of Nω-methyl-L-arginine (CHEBI:28229) |
| IUPAC Names |
|---|
| (2S)-2-amino-5-(N'-methylcarbamimidamido)pentanoic acid |
| (2S)-2-amino-5-{[imino(methylamino)methyl]amino}pentanoic acid |
| N5-(N-methylcarbamimidoyl)-L-ornithine |
| N5-[imino(methylamino)methyl]-L-ornithine |
| INNs | Source |
|---|---|
| tilarginina | ChEBI |
| tilarginine | ChemIDplus |
| tilargininum | ChEBI |
| Synonyms | Source |
|---|---|
| acide (2S)-2-amino-5-(3-méthylguanidino)pentanoïque | ChEBI |
| N-monomethyl-L-arginine | ChemIDplus |
| N5-(methylamidino)-L-ornithine | ChemIDplus |
| N5-(metilamidino)-L-ornitina | ChEBI |
| NG-monomethyl-L-arginine | ChemIDplus |
| Ngamma-Monomethyl-L-arginine | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2262067 | Beilstein |
| CAS:17035-90-4 | ChemIDplus |
| Citations |
|---|