EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:218793 - 5-hydroxymethylfuran-3-carboxylic acid
| Formula | C6H6O4 |
| Net Charge | 0 |
| Average Mass | 142.110 |
| Monoisotopic Mass | 142.02661 |
| SMILES | O=C(O)c1coc(CO)c1 |
| InChI | InChI=1S/C6H6O4/c7-2-5-1-4(3-10-5)6(8)9/h1,3,7H,2H2,(H,8,9) |
| InChIKey | ZEACFIAQNKKVPN-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Polyporus ciliatus (ncbitaxon:134555) | - | PubMed (12169314) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-hydroxymethylfuran-3-carboxylic acid (CHEBI:218793) is a furoic acid (CHEBI:36055) |
| IUPAC Name |
|---|
| 5-(hydroxymethyl)uran-3-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 28130137 | ChemSpider |