EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:17394 - N5-ethyl-L-glutamine
| Formula | C7H14N2O3 |
| Net Charge | 0 |
| Average Mass | 174.200 |
| Monoisotopic Mass | 174.10044 |
| SMILES | CCNC(=O)CC[C@H](N)C(=O)O |
| InChI | InChI=1S/C7H14N2O3/c1-2-9-6(10)4-3-5(8)7(11)12/h5H,2-4,8H2,1H3,(H,9,10)(H,11,12)/t5-/m0/s1 |
| InChIKey | DATAGRPVKZEWHA-YFKPBYRVSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N5-ethyl-L-glutamine (CHEBI:17394) has role geroprotector (CHEBI:176497) |
| N5-ethyl-L-glutamine (CHEBI:17394) has role neuroprotective agent (CHEBI:63726) |
| N5-ethyl-L-glutamine (CHEBI:17394) has role plant metabolite (CHEBI:76924) |
| N5-ethyl-L-glutamine (CHEBI:17394) is a N5-alkyl-L-glutamine (CHEBI:21844) |
| N5-ethyl-L-glutamine (CHEBI:17394) is tautomer of N5-ethyl-L-glutamine zwitterion (CHEBI:58128) |
| Incoming Relation(s) |
| N5-ethyl-L-glutamine zwitterion (CHEBI:58128) is tautomer of N5-ethyl-L-glutamine (CHEBI:17394) |
| IUPAC Names |
|---|
| (2S)-2-amino-5-(ethylamino)-5-oxopentanoic acid |
| N5-ethyl-L-glutamine |
| Synonyms | Source |
|---|---|
| N5-Ethyl-L-glutamine | KEGG COMPOUND |
| L-theanine | ChemIDplus |
| L-Theanine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C01047 | KEGG COMPOUND |
| L-theanine | Wikipedia |
| HMDB0034365 | HMDB |
| 85G | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1725586 | Reaxys |
| CAS:3081-61-6 | ChemIDplus |
| CAS:3081-61-6 | KEGG COMPOUND |
| Citations |
|---|