EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H20O6 |
| Net Charge | 0 |
| Average Mass | 296.319 |
| Monoisotopic Mass | 296.12599 |
| SMILES | CC(O)C(O)/C=C/C1=CC2=CC(=O)[C@@](C)(O)[C@H](O)[C@H]2CO1 |
| InChI | InChI=1S/C15H20O6/c1-8(16)12(17)4-3-10-5-9-6-13(18)15(2,20)14(19)11(9)7-21-10/h3-6,8,11-12,14,16-17,19-20H,7H2,1-2H3/b4-3+/t8?,11-,12?,14+,15+/m0/s1 |
| InChIKey | PQRIHIGISJBVGT-SDYNDRPMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Irpex lacteus (ncbitaxon:5319) | - | PubMed (30076888) |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nigirpexin D (CHEBI:218079) is a azaphilone (CHEBI:50941) |
| IUPAC Name |
|---|
| (7S,8R,8aR)-3-[(E)-3,4-dihydroxypent-1-enyl]-7,8-dihydroxy-7-methyl-8,8a-dihydro-1H-isochromen-6-one |