EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H20O4 |
| Net Charge | 0 |
| Average Mass | 264.321 |
| Monoisotopic Mass | 264.13616 |
| SMILES | C/C=C/C=C/[C@@H]1CC2=C(CO1)C(=O)[C@](C)(O)[C@@H](O)C2 |
| InChI | InChI=1S/C15H20O4/c1-3-4-5-6-11-7-10-8-13(16)15(2,18)14(17)12(10)9-19-11/h3-6,11,13,16,18H,7-9H2,1-2H3/b4-3+,6-5+/t11-,13+,15-/m1/s1 |
| InChIKey | YULGBWALIANZCW-WDBKTXKOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Irpex lacteus (ncbitaxon:5319) | - | PubMed (30076888) |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nigirpexin C (CHEBI:218075) is a azaphilone (CHEBI:50941) |
| IUPAC Name |
|---|
| (3S,6S,7R)-6,7-dihydroxy-7-methyl-3-[(1E,3E)-penta-1,3-dienyl]-3,4,5,6-tetrahydro-1H-isochromen-8-one |