EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H27ClO6 |
| Net Charge | 0 |
| Average Mass | 386.872 |
| Monoisotopic Mass | 386.14962 |
| SMILES | CC[C@H](C)[C@@H](O)[C@@](C)(O)/C=C/C1=CC2=C(Cl)C(=O)[C@](C)(O)[C@H](O)[C@@H]2CO1 |
| InChI | InChI=1S/C19H27ClO6/c1-5-10(2)15(21)18(3,24)7-6-11-8-12-13(9-26-11)16(22)19(4,25)17(23)14(12)20/h6-8,10,13,15-16,21-22,24-25H,5,9H2,1-4H3/b7-6+/t10-,13+,15+,16+,18-,19+/m0/s1 |
| InChIKey | CPMFRQHRPWPNMP-JRMQMFIBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicilliumspecies 6A-9 (ncbitaxon:1586111) | - | DOI (10.1016/j.tetlet.2018.06.057) |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Eupenicilazaphilone A (CHEBI:218013) is a azaphilone (CHEBI:50941) |
| IUPAC Name |
|---|
| (7R,8R,8aS)-5-chloro-3-[(E,3S,4R,5S)-3,4-dihydroxy-3,5-dimethylhept-1-enyl]-7,8-dihydroxy-7-methyl-8,8a-dihydro-1H-isochromen-6-one |
| Manual Xrefs | Databases |
|---|---|
| 71044339 | ChemSpider |