EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H24Cl2O7 |
| Net Charge | 0 |
| Average Mass | 483.344 |
| Monoisotopic Mass | 482.08991 |
| SMILES | C/C=C/C1=CC2=CC(=O)[C@](C)(OC(=O)c3c(C)c(Cl)c(OC)c(Cl)c3OC)[C@@H](O)[C@@H]2CO1 |
| InChI | InChI=1S/C23H24Cl2O7/c1-6-7-13-8-12-9-15(26)23(3,21(27)14(12)10-31-13)32-22(28)16-11(2)17(24)20(30-5)18(25)19(16)29-4/h6-9,14,21,27H,10H2,1-5H3/b7-6+/t14-,21+,23+/m1/s1 |
| InChIKey | UPGFIGSJKQUWJR-AHFGERQWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus (ncbitaxon:5052) | - | DOI (10.1248/cpb.40.3142) |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Falconensin A (CHEBI:217909) is a azaphilone (CHEBI:50941) |
| IUPAC Name |
|---|
| [(7R,8S,8aS)-8-hydroxy-7-methyl-6-oxo-3-[(E)-prop-1-enyl]-8,8a-dihydro-1H-isochromen-7-yl] 3,5-dichloro-2,4-dimethoxy-6-methylbenzoate |
| Manual Xrefs | Databases |
|---|---|
| 8520648 | ChemSpider |