EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H24O7 |
| Net Charge | 0 |
| Average Mass | 400.427 |
| Monoisotopic Mass | 400.15220 |
| SMILES | C/C=C/C1=CC2=C(CO1)C(=O)[C@@](C)(OC(=O)c1c(C)cc(O)cc1OC)[C@@H](O)C2 |
| InChI | InChI=1S/C22H24O7/c1-5-6-15-8-13-9-18(24)22(3,20(25)16(13)11-28-15)29-21(26)19-12(2)7-14(23)10-17(19)27-4/h5-8,10,18,23-24H,9,11H2,1-4H3/b6-5+/t18-,22-/m0/s1 |
| InChIKey | KFFKMHLZUAKCOH-IHMXKHASSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Talaromycesspecies (ncbitaxon:1707706) | - | PubMed (18308572) |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Kasanosin C (CHEBI:214918) is a azaphilone (CHEBI:50941) |
| IUPAC Name |
|---|
| [(6S,7S)-6-hydroxy-7-methyl-8-oxo-3-[(E)-prop-1-enyl]-5,6-dihydro-1H-isochromen-7-yl] 4-hydroxy-2-methoxy-6-methylbenzoate |
| Manual Xrefs | Databases |
|---|---|
| 78437526 | ChemSpider |