EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10O8 |
| Net Charge | 0 |
| Average Mass | 210.138 |
| Monoisotopic Mass | 210.03757 |
| SMILES | O=C(O)[C@H](O)[C@H](O)[C@H](O)[C@@H](O)C(=O)O |
| WURCS | WURCS=2.0/1,1,0/[A2221A]/1/ |
| InChI | InChI=1S/C6H10O8/c7-1(3(9)5(11)12)2(8)4(10)6(13)14/h1-4,7-10H,(H,11,12)(H,13,14)/t1-,2+,3-,4-/m1/s1 |
| InChIKey | DSLZVSRJTYRBFB-GJPGBQJBSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-altraric acid (CHEBI:21398) has role bacterial metabolite (CHEBI:76969) |
| L-altraric acid (CHEBI:21398) is a altraric acid (CHEBI:26847) |
| L-altraric acid (CHEBI:21398) is conjugate acid of L-altrarate(1−) (CHEBI:21397) |
| L-altraric acid (CHEBI:21398) is enantiomer of D-altraric acid (CHEBI:21101) |
| Incoming Relation(s) |
| L-altrarate(1−) (CHEBI:21397) is conjugate base of L-altraric acid (CHEBI:21398) |
| D-altraric acid (CHEBI:21101) is enantiomer of L-altraric acid (CHEBI:21398) |
| IUPAC Name |
|---|
| L-altraric acid |
| Synonyms | Source |
|---|---|
| L-talaric acid | ChEBI |
| (2R,3R,4S,5R)-2,3,4,5-tetrahydroxyhexanedioic acid | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1728118 | Reaxys |