EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H.C6H8O8 |
| Net Charge | -1 |
| Average Mass | 209.130 |
| Monoisotopic Mass | 209.03029 |
| SMILES | O=C([O-])[C@H](O)[C@H](O)[C@H](O)[C@@H](O)C(=O)[O-].[H+] |
| InChI | InChI=1S/C6H10O8/c7-1(3(9)5(11)12)2(8)4(10)6(13)14/h1-4,7-10H,(H,11,12)(H,13,14)/p-1/t1-,2+,3-,4-/m1/s1 |
| InChIKey | DSLZVSRJTYRBFB-GJPGBQJBSA-M |
| Roles Classification |
|---|
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-altrarate(1−) (CHEBI:21397) has role bacterial metabolite (CHEBI:76969) |
| L-altrarate(1−) (CHEBI:21397) is a altrarate(1−) (CHEBI:35389) |
| L-altrarate(1−) (CHEBI:21397) is conjugate acid of L-altrarate(2−) (CHEBI:37547) |
| L-altrarate(1−) (CHEBI:21397) is conjugate base of L-altraric acid (CHEBI:21398) |
| L-altrarate(1−) (CHEBI:21397) is enantiomer of D-altrarate(1−) (CHEBI:21100) |
| Incoming Relation(s) |
| L-altraric acid (CHEBI:21398) is conjugate acid of L-altrarate(1−) (CHEBI:21397) |
| L-altrarate(2−) (CHEBI:37547) is conjugate base of L-altrarate(1−) (CHEBI:21397) |
| D-altrarate(1−) (CHEBI:21100) is enantiomer of L-altrarate(1−) (CHEBI:21397) |
| IUPAC Name |
|---|
| hydrogen L-altrarate |
| Synonym | Source |
|---|---|
| L-talarate | ChEBI |
| Citations |
|---|