EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H18O4 |
| Net Charge | 0 |
| Average Mass | 262.305 |
| Monoisotopic Mass | 262.12051 |
| SMILES | CC1=C2CC(C)(C)C[C@H]2[C@H](O)c2coc(C(=O)O)c21 |
| InChI | InChI=1S/C15H18O4/c1-7-8-4-15(2,3)5-9(8)12(16)10-6-19-13(11(7)10)14(17)18/h6,9,12,16H,4-5H2,1-3H3,(H,17,18)/t9-,12+/m1/s1 |
| InChIKey | DGPKQXFVKQMEKD-SKDRFNHKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Clavicorona (ncbitaxon:48020) | - | DOI (10.1016/s0040-4020(03)00738-5) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Tsugicoline M (CHEBI:213805) is a furoic acid (CHEBI:36055) |
| IUPAC Name |
|---|
| (4S,4aR)-4-hydroxy-6,6,8-trimethyl-4,4a,5,7-tetrahydrocyclopenta[][2]benzouran-1-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 8440157 | ChemSpider |